CAS 1082558-35-7 appears in our catalog under these names: 2-(3,4-Difluorophenoxy)-2-phenylacetic acid, 95%, 2-(3,4-Difluorophenoxy)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3,4-difluorophenoxy)-2-phenylacetic acid (CAS 1082558-35-7) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2-(3,4-difluorophenoxy)-2-phenylacetic acid. InChIKey: PQXORHRYFJUBNP-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2-(3,4-difluorophenoxy)-2-phenylacetic acid |
| InChIKey | PQXORHRYFJUBNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)