CAS 1087-09-8 appears in our catalog under these names: 1,4-Diphenyl-2-butyne-1,4-dione, 95%, 1,4–Diphenyl–2–butyne–1,4–dione, 1,4-Diphenyl-2-butyne-1,4-dione, >96.0%(GC), 1,4-Diphenyl-2-butyne-1,4-dione, 96.0%, 96.0%, 1,4-Diphenylbut-2-yne-1,4-dione. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1,4-diphenylbut-2-yne-1,4-dione (CAS 1087-09-8) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 1,4-diphenylbut-2-yne-1,4-dione. InChIKey: BLCJVQFFSUNDMV-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1,4-diphenylbut-2-yne-1,4-dione |
| InChIKey | BLCJVQFFSUNDMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C#CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)