CAS 1262433-90-8 appears in our catalog under these names: Anthracene-2,6-dicarbaldehyde, 97%, Anthracene–2,6–dicarbaldehyde. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
Anthracene-2,6-dicarbaldehyde (CAS 1262433-90-8) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: anthracene-2,6-dicarbaldehyde. InChIKey: PUNRKTIWVHIPLU-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | anthracene-2,6-dicarbaldehyde |
| InChIKey | PUNRKTIWVHIPLU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=CC(=C3)C=O)C=C2C=C1C=O |
Computed by PubChem (NCBI)