Products 41014-29-3
CAS 41014-29-3 is the registry number for 2,2'-Bibenzofuran, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-benzofuran-2-yl)-1-benzofuran (CAS 41014-29-3) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-1-benzofuran. InChIKey: AZTLWEXIUZBRGD-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-1-benzofuran |
| InChIKey | AZTLWEXIUZBRGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=CC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)