CAS 34824-75-4 is the registry number for Anthracene-1,8-dicarbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Anthracene-1,8-dicarbaldehyde (CAS 34824-75-4) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: anthracene-1,8-dicarbaldehyde. InChIKey: UFEHDZBGPNZLQG-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | anthracene-1,8-dicarbaldehyde |
| InChIKey | UFEHDZBGPNZLQG-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=C2C(=C1)C=O)C(=CC=C3)C=O |
Computed by PubChem (NCBI)