CAS 2348-77-8 is the registry number for Anti-infective agent 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-phenylnaphthalene-1,4-dione (CAS 2348-77-8) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 2-phenylnaphthalene-1,4-dione. InChIKey: CIDYIYSNDAJNGX-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-phenylnaphthalene-1,4-dione |
| InChIKey | CIDYIYSNDAJNGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)