CAS 84907-55-1 appears in our catalog under these names: 4,4'–(Ethyne–1,2–diyl)dibenzaldehyde, 4,4'-(Ethyne-1,2-diyl)dibenzaldehyde, 98%, 98%, 4,4'-(Ethyne-1,2-diyl)dibenzaldehyde, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-[2-(4-formylphenyl)ethynyl]benzaldehyde (CAS 84907-55-1) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 4-[2-(4-formylphenyl)ethynyl]benzaldehyde. InChIKey: IZJKYSQCRNPJHX-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 4-[2-(4-formylphenyl)ethynyl]benzaldehyde |
| InChIKey | IZJKYSQCRNPJHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C#CC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)