CAS 13388-33-5 appears in our catalog under these names: 2-Vinylanthraquinone, 97%, 2-Vinylanthraquinone, 98% mix TBC as stabilizer, 2–Vinylanthraquinone, 2-Vinylanthraquinone, >98.0%(GC), 2-Vinylanthraquinone, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-ethenylanthracene-9,10-dione (CAS 13388-33-5) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 2-ethenylanthracene-9,10-dione. InChIKey: IQOUOAIZDKROQT-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-ethenylanthracene-9,10-dione |
| InChIKey | IQOUOAIZDKROQT-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)