CAS 5381-33-9 is the registry number for 2-Benzylidene-1H-indene-1,3(2H)-dione, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-benzylideneindene-1,3-dione (CAS 5381-33-9) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: 2-benzylideneindene-1,3-dione. InChIKey: OPKPFEWFKYKJCF-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-benzylideneindene-1,3-dione |
| InChIKey | OPKPFEWFKYKJCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=C2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)