CAS 155169-39-4 is the registry number for 2,7-Dihydroxypyrene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Pyrene-2,7-diol (CAS 155169-39-4) is a chemical compound with the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. IUPAC name: pyrene-2,7-diol. InChIKey: QKYIPVJKWYKQLX-UHFFFAOYSA-N.
| Molecular formula | C16H10O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | pyrene-2,7-diol |
| InChIKey | QKYIPVJKWYKQLX-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C4=C(C=C3)C=C(C=C41)O)O |
Computed by PubChem (NCBI)