CAS 1093123-73-9 appears in our catalog under these names: [(1,1-Dioxidotetrahydrothien-3-yl)amino]acetic acid hydrochloride, 95%, (1,1-Dioxidotetrahydrothiophen-3-yl)glycine hydrochloride, 98%, N-​(Tetrahydro-​1,​1-​dioxido-​3-​thienyl)​-​glycine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[(1,1-dioxothiolan-3-yl)amino]acetic acid;hydrochloride (CAS 1093123-73-9) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid;hydrochloride. InChIKey: BQOGPKYVTQMVRQ-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid;hydrochloride |
| InChIKey | BQOGPKYVTQMVRQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NCC(=O)O.Cl |
Computed by PubChem (NCBI)