CAS 2247102-28-7 is the registry number for Methyl 4-amino-1,1-dioxo-1λ6-thiolane-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-amino-1,1-dioxothiolane-2-carboxylate;hydrochloride (CAS 2247102-28-7) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: methyl 4-amino-1,1-dioxothiolane-2-carboxylate;hydrochloride. InChIKey: NFVRBGYBLMJKER-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | methyl 4-amino-1,1-dioxothiolane-2-carboxylate;hydrochloride |
| InChIKey | NFVRBGYBLMJKER-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(CS1(=O)=O)N.Cl |
Computed by PubChem (NCBI)