CAS 1803582-09-3 appears in our catalog under these names: 2-(3-Amino-1,1-dioxothiolan-3-yl)acetic acid hydrochloride, 2-(3-Amino-1,1-dioxo-1lambda(6)-thiolan-3-yl)acetic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 5g, 1g, 250mg.
2-(3-amino-1,1-dioxothiolan-3-yl)acetic acid;hydrochloride (CAS 1803582-09-3) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 2-(3-amino-1,1-dioxothiolan-3-yl)acetic acid;hydrochloride. InChIKey: PTQVOATZZDYZAP-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 2-(3-amino-1,1-dioxothiolan-3-yl)acetic acid;hydrochloride |
| InChIKey | PTQVOATZZDYZAP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)