CAS 1803561-91-2 appears in our catalog under these names: 3-Aminotetrahydro-2H-thiopyran-3-carboxylic acid 1,1-dioxide hydrochloride, 98%, 3-amino-1,1-dioxothiane-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
3-amino-1,1-dioxothiane-3-carboxylic acid;hydrochloride (CAS 1803561-91-2) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 3-amino-1,1-dioxothiane-3-carboxylic acid;hydrochloride. InChIKey: AFSNRAWWCZNLSK-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 3-amino-1,1-dioxothiane-3-carboxylic acid;hydrochloride |
| InChIKey | AFSNRAWWCZNLSK-UHFFFAOYSA-N |
| SMILES | C1CC(CS(=O)(=O)C1)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)