CAS 2138023-12-6 appears in our catalog under these names: Rel-methyl (3R,4S)-4-aminotetrahydrothiophene-3-carboxylate 1,1-dioxide hydrochloride, 98%, rac-Methyl (3R,4S)-4-amino-1,1-dioxo-1λ6-thiolane-3-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Methyl (3R,4S)-4-amino-1,1-dioxothiolane-3-carboxylate;hydrochloride (CAS 2138023-12-6) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: methyl (3R,4S)-4-amino-1,1-dioxothiolane-3-carboxylate;hydrochloride. InChIKey: LUAUITQJVJXWHL-TYSVMGFPSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | methyl (3R,4S)-4-amino-1,1-dioxothiolane-3-carboxylate;hydrochloride |
| InChIKey | LUAUITQJVJXWHL-TYSVMGFPSA-N |
| SMILES | COC(=O)[C@@H]1CS(=O)(=O)C[C@H]1N.Cl |
Computed by PubChem (NCBI)