CAS 1384429-47-3 appears in our catalog under these names: 2-(1,1-Dioxidothiomorpholin-3-yl)acetic acid hydrochloride, 98%, 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-(1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride (CAS 1384429-47-3) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride. InChIKey: ZYWBEYIQCPUMIY-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride |
| InChIKey | ZYWBEYIQCPUMIY-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(N1)CC(=O)O.Cl |
Computed by PubChem (NCBI)