Products 2137458-07-0

CAS 2137458-07-0 is the registry number for Methyl thiomorpholine-3-carboxylate 1,1-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride (CAS 2137458-07-0) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: methyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride. InChIKey: DSTXORXRAVFIDY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO4S
Molecular weight229.68 g/mol
IUPAC namemethyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride
InChIKeyDSTXORXRAVFIDY-UHFFFAOYSA-N
SMILESCOC(=O)C1CS(=O)(=O)CCN1.Cl

Computed by PubChem (NCBI)