CAS 2137458-07-0 is the registry number for Methyl thiomorpholine-3-carboxylate 1,1-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride (CAS 2137458-07-0) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: methyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride. InChIKey: DSTXORXRAVFIDY-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | methyl 1,1-dioxo-1,4-thiazinane-3-carboxylate;hydrochloride |
| InChIKey | DSTXORXRAVFIDY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CS(=O)(=O)CCN1.Cl |
Computed by PubChem (NCBI)