Products 2247104-23-8

CAS 2247104-23-8 is the registry number for 1,1-Dioxo-1,4-thiazepane-6-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride (CAS 2247104-23-8) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride. InChIKey: HNGZHAALCIJIKE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO4S
Molecular weight229.68 g/mol
IUPAC name1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride
InChIKeyHNGZHAALCIJIKE-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC(CN1)C(=O)O.Cl

Computed by PubChem (NCBI)