CAS 2247104-23-8 is the registry number for 1,1-Dioxo-1,4-thiazepane-6-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride (CAS 2247104-23-8) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: 1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride. InChIKey: HNGZHAALCIJIKE-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 1,1-dioxo-1,4-thiazepane-6-carboxylic acid;hydrochloride |
| InChIKey | HNGZHAALCIJIKE-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(CN1)C(=O)O.Cl |
Computed by PubChem (NCBI)