Products 1401785-84-9
CAS 1401785-84-9 is the registry number for methyl 2-(azetidine-3-sulfonyl)acetate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 2-(azetidin-3-ylsulfonyl)acetate;hydrochloride (CAS 1401785-84-9) is a chemical compound with the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. IUPAC name: methyl 2-(azetidin-3-ylsulfonyl)acetate;hydrochloride. InChIKey: WMQHCNQWGMVWRS-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO4S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | methyl 2-(azetidin-3-ylsulfonyl)acetate;hydrochloride |
| InChIKey | WMQHCNQWGMVWRS-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)C1CNC1.Cl |
Computed by PubChem (NCBI)