CAS 1094236-98-2 is the registry number for (5-Chloro-2-(difluoromethoxy)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
[5-chloro-2-(difluoromethoxy)phenyl]methanamine (CAS 1094236-98-2) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: [5-chloro-2-(difluoromethoxy)phenyl]methanamine. InChIKey: TUCKCIJXTOOLEL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | [5-chloro-2-(difluoromethoxy)phenyl]methanamine |
| InChIKey | TUCKCIJXTOOLEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CN)OC(F)F |
Computed by PubChem (NCBI)