CAS 2172532-55-5 is the registry number for 1-(3-Aminophenyl)-2,2-difluoroethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-aminophenyl)-2,2-difluoroethanone;hydrochloride (CAS 2172532-55-5) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 1-(3-aminophenyl)-2,2-difluoroethanone;hydrochloride. InChIKey: KBRAMYLPVCQWIJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2,2-difluoroethanone;hydrochloride |
| InChIKey | KBRAMYLPVCQWIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)C(F)F.Cl |
Computed by PubChem (NCBI)