Products 72324-45-9
CAS 72324-45-9 is the registry number for Ethyl 3-[(3,5-dichlorophenyl)amino]-3-oxopropanoate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
Ethyl 3-(3,5-dichloroanilino)-3-oxopropanoate (CAS 72324-45-9) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: ethyl 3-(3,5-dichloroanilino)-3-oxopropanoate. InChIKey: UZUJVOXDFWXBTB-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | ethyl 3-(3,5-dichloroanilino)-3-oxopropanoate |
| InChIKey | UZUJVOXDFWXBTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)NC1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)