Products 1429056-28-9
CAS 1429056-28-9 appears in our catalog under these names: 2-Oxa-7-azaspiro(3.5)nonane Hemioxalate, 2–Oxa–7–azaspiro(3·5)nonane Hemioxalate, 2-Oxa-7-azaspiro¬3.5|nonane hemioxalate, 97% , 2-Oxa-7-azaspiro[3.5]nonane Hemioxalate, >97.0%(T), 2-Oxa-7-azaspiro[3.5]nonane oxalate(2:1) 96%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
Bis(2-oxa-7-azaspiro[3.5]nonane);oxalic acid (CAS 1429056-28-9) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: bis(2-oxa-7-azaspiro[3.5]nonane);oxalic acid. InChIKey: WWVUFRRXXSVWBJ-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | bis(2-oxa-7-azaspiro[3.5]nonane);oxalic acid |
| InChIKey | WWVUFRRXXSVWBJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC12COC2.C1CNCCC12COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)