CAS 2920763-66-0 is the registry number for (S)-2-(3,4-Bis(tert-butoxycarbonyl)piperazin-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3S)-3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]acetic acid (CAS 2920763-66-0) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 2-[(3S)-3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]acetic acid. InChIKey: DQMMEZAISSVFTO-NSHDSACASA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 2-[(3S)-3,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]acetic acid |
| InChIKey | DQMMEZAISSVFTO-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CN(CCN1C(=O)OC(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)