Products 1108699-37-1
CAS 1108699-37-1 is the registry number for Methyl 4'-vinyl-[1,1'-biphenyl]-4-carboxylate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-(4-ethenylphenyl)benzoate (CAS 1108699-37-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: methyl 4-(4-ethenylphenyl)benzoate. InChIKey: SLYPHJUWBOWGFG-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl 4-(4-ethenylphenyl)benzoate |
| InChIKey | SLYPHJUWBOWGFG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)