Products 1112213-20-3

CAS 1112213-20-3 is the registry number for 3-Amino-6-chloropyridine-2-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-amino-6-chloropyridine-2-carboxylic acid;hydrochloride (CAS 1112213-20-3) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 3-amino-6-chloropyridine-2-carboxylic acid;hydrochloride. InChIKey: GBRRURQFMSIEKB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl2N2O2
Molecular weight209.03 g/mol
IUPAC name3-amino-6-chloropyridine-2-carboxylic acid;hydrochloride
InChIKeyGBRRURQFMSIEKB-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1N)C(=O)O)Cl.Cl

Computed by PubChem (NCBI)