CAS 1881321-84-1 is the registry number for 2-chloro-5-nitroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-5-nitroaniline;hydrochloride (CAS 1881321-84-1) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 2-chloro-5-nitroaniline;hydrochloride. InChIKey: NFYWABKQXIXBLN-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 2-chloro-5-nitroaniline;hydrochloride |
| InChIKey | NFYWABKQXIXBLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)Cl.Cl |
Computed by PubChem (NCBI)