CAS 1803590-09-1 appears in our catalog under these names: 2-Chloro-3-nitroaniline hydrochloride, 2-Chloro-3-nitroaniline hydrochloride, 97%, 97%, 2-Chloro-3-nitroaniline hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g.
2-chloro-3-nitroaniline;hydrochloride (CAS 1803590-09-1) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 2-chloro-3-nitroaniline;hydrochloride. InChIKey: XQVYCAHHMDGVJV-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 2-chloro-3-nitroaniline;hydrochloride |
| InChIKey | XQVYCAHHMDGVJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)N.Cl |
Computed by PubChem (NCBI)