CAS 2117371-86-3 is the registry number for Methyl 2,4-dichloro-1-methyl-1H-imidazole-5-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2,5-dichloro-3-methylimidazole-4-carboxylate (CAS 2117371-86-3) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: methyl 2,5-dichloro-3-methylimidazole-4-carboxylate. InChIKey: DFYUIKFFSUIUGP-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-methylimidazole-4-carboxylate |
| InChIKey | DFYUIKFFSUIUGP-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)