CAS 1228551-78-7 appears in our catalog under these names: (4,5-Dichloro-3-methyl-1h-pyrazol-1-yl)acetic acid, 95%, 2-(4,5-Dichloro-3-methyl-1H-pyrazol-1-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(4,5-dichloro-3-methylpyrazol-1-yl)acetic acid (CAS 1228551-78-7) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 2-(4,5-dichloro-3-methylpyrazol-1-yl)acetic acid. InChIKey: TWZKQIAHXWYVGH-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 2-(4,5-dichloro-3-methylpyrazol-1-yl)acetic acid |
| InChIKey | TWZKQIAHXWYVGH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)