CAS 2419176-23-9 is the registry number for 4-Amino-5-chloropicolinic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride (CAS 2419176-23-9) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride. InChIKey: BIPLJYWMPCPNBC-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride |
| InChIKey | BIPLJYWMPCPNBC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(=O)O)Cl)N.Cl |
Computed by PubChem (NCBI)