Products 2419176-23-9

CAS 2419176-23-9 is the registry number for 4-Amino-5-chloropicolinic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride (CAS 2419176-23-9) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride. InChIKey: BIPLJYWMPCPNBC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl2N2O2
Molecular weight209.03 g/mol
IUPAC name4-amino-5-chloropyridine-2-carboxylic acid;hydrochloride
InChIKeyBIPLJYWMPCPNBC-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1C(=O)O)Cl)N.Cl

Computed by PubChem (NCBI)