CAS 64736-58-9 appears in our catalog under these names: Ethyl 4,5-dichloro-1H-imidazole-2-carboxylate, 95%, 1H-Imidazole-2-carboxylic acid, 4,5-dichloro-, ethyl ester, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Ethyl 4,5-dichloro-1H-imidazole-2-carboxylate (CAS 64736-58-9) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: ethyl 4,5-dichloro-1H-imidazole-2-carboxylate. InChIKey: VLUBCRVJZVBQGI-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | ethyl 4,5-dichloro-1H-imidazole-2-carboxylate |
| InChIKey | VLUBCRVJZVBQGI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(N1)Cl)Cl |
Computed by PubChem (NCBI)