Products 2763751-17-1

CAS 2763751-17-1 is the registry number for 6-Chloro-3-methylpyridazine-4-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloro-3-methylpyridazine-4-carboxylic acid;hydrochloride (CAS 2763751-17-1) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 6-chloro-3-methylpyridazine-4-carboxylic acid;hydrochloride. InChIKey: ZFAXVQSOJYHVFA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl2N2O2
Molecular weight209.03 g/mol
IUPAC name6-chloro-3-methylpyridazine-4-carboxylic acid;hydrochloride
InChIKeyZFAXVQSOJYHVFA-UHFFFAOYSA-N
SMILESCC1=NN=C(C=C1C(=O)O)Cl.Cl

Computed by PubChem (NCBI)