Products 69696-56-6
CAS 69696-56-6 is the registry number for 4,5-Dichloro-2-(2-hydroxyethyl)pyridazin-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-(2-hydroxyethyl)pyridazin-3-one (CAS 69696-56-6) is a chemical compound with the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. IUPAC name: 4,5-dichloro-2-(2-hydroxyethyl)pyridazin-3-one. InChIKey: KJTPJUSIEGWXAT-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 4,5-dichloro-2-(2-hydroxyethyl)pyridazin-3-one |
| InChIKey | KJTPJUSIEGWXAT-UHFFFAOYSA-N |
| SMILES | C1=NN(C(=O)C(=C1Cl)Cl)CCO |
Computed by PubChem (NCBI)