CAS 1171764-46-7 appears in our catalog under these names: 3-(2-Oxo-1,2-dihydropyrimidin-1-yl)propanoic acid hydrochloride, 95%, 3-(2-Oxo-1,2-dihydropyrimidin-1-yl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(2-oxopyrimidin-1-yl)propanoic acid;hydrochloride (CAS 1171764-46-7) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 3-(2-oxopyrimidin-1-yl)propanoic acid;hydrochloride. InChIKey: AVDPBFOBSNQKKL-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 3-(2-oxopyrimidin-1-yl)propanoic acid;hydrochloride |
| InChIKey | AVDPBFOBSNQKKL-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)N=C1)CCC(=O)O.Cl |
Computed by PubChem (NCBI)