Products 1794877-91-0
CAS 1794877-91-0 is the registry number for O-4-Nitrobenzylhydroxylamine-d6 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
O-[dideuterio-(2,3,5,6-tetradeuterio-4-nitrophenyl)methyl]hydroxylamine;hydrochloride (CAS 1794877-91-0) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 210.65 g/mol. IUPAC name: O-[dideuterio-(2,3,5,6-tetradeuterio-4-nitrophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LKCAFSOYOMFQSL-UNJHBGEESA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | O-[dideuterio-(2,3,5,6-tetradeuterio-4-nitrophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LKCAFSOYOMFQSL-UNJHBGEESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])ON)[2H])[2H])[N+](=O)[O-])[2H].Cl |
Computed by PubChem (NCBI)