CAS 59703-00-3 appears in our catalog under these names: Cefoperazone Impurity 1, 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl Chloride, c4-Ethyl-2,3-dioxo-piperazine carbonyl chloride, 4-Ethyl-2,3-dioxopiperazine-1-carbonyl chloride 95%, 4-ETHYL-2,3-DIOXOPIPERAZINE-1-CARBONYL CHLORIDE, ≥95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Fluorochem. Available pack sizes: on request, 1g, 25g, 1000g, 500g, 5g, 10g, 100g.
4-ethyl-2,3-dioxopiperazine-1-carbonyl chloride (CAS 59703-00-3) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 4-ethyl-2,3-dioxopiperazine-1-carbonyl chloride. InChIKey: SXVBQOZRZIUHKU-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 4-ethyl-2,3-dioxopiperazine-1-carbonyl chloride |
| InChIKey | SXVBQOZRZIUHKU-UHFFFAOYSA-N |
| SMILES | CCN1CCN(C(=O)C1=O)C(=O)Cl |
Computed by PubChem (NCBI)