CAS 114776-15-7 appears in our catalog under these names: 2-Chloro-4-fluoro-5-nitrobenzoic Acid, 2–Chloro–4–fluoro–5–nitrobenzoic Acid, 2-Chloro-4-fluoro-5-nitrobenzoic Acid, >98.0%(GC)(T), 2-Chloro-4-fluoro-5-nitrobenzoic acid 96%, Benzoic acid, 2-chloro-4-fluoro-5-nitro-, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 2,5g, 250mg, 100g, 25g, 5g, 10g, 500g.
2-chloro-4-fluoro-5-nitrobenzoic acid (CAS 114776-15-7) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 2-chloro-4-fluoro-5-nitrobenzoic acid. InChIKey: SYZKAFCPWNFONG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-nitrobenzoic acid |
| InChIKey | SYZKAFCPWNFONG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)Cl)C(=O)O |
Computed by PubChem (NCBI)