CAS 138762-97-7 appears in our catalog under these names: 5-Chloro-4-fluoro-2-nitrobenzoic acid, 97%, 5-Chloro-4-fluoro-2-nitrobenzoic acid, 98%, 98%, 5-CHLORO-4-FLUORO-2-NITRO-BENZOIC ACID, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
5-chloro-4-fluoro-2-nitrobenzoic acid (CAS 138762-97-7) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 5-chloro-4-fluoro-2-nitrobenzoic acid. InChIKey: SYQPHIBSUVTKAV-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-nitrobenzoic acid |
| InChIKey | SYQPHIBSUVTKAV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)