Products 1610927-39-3
CAS 1610927-39-3 appears in our catalog under these names: 2-Chloro-3-fluoro-6-nitrobenzoic acid, 95%, 2-Chloro-3-fluoro-6-nitro-benzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-3-fluoro-6-nitrobenzoic acid (CAS 1610927-39-3) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 2-chloro-3-fluoro-6-nitrobenzoic acid. InChIKey: SIHIQTGCFIZTHN-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 2-chloro-3-fluoro-6-nitrobenzoic acid |
| InChIKey | SIHIQTGCFIZTHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)Cl)F |
Computed by PubChem (NCBI)