CAS 1804879-14-8 is the registry number for 4-Chloro-3-fluoro-5-nitrobenzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-3-fluoro-5-nitrobenzoic acid (CAS 1804879-14-8) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 4-chloro-3-fluoro-5-nitrobenzoic acid. InChIKey: OTJZEAGZIMBMFE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-nitrobenzoic acid |
| InChIKey | OTJZEAGZIMBMFE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)F)C(=O)O |
Computed by PubChem (NCBI)