Products 206884-30-2
CAS 206884-30-2 appears in our catalog under these names: 2-chloro-6-fluoro-3-nitrobenzoic acid, 2-Chloro-6-fluoro-3-nitrobenzoic acid, 97%, 2–Chloro–6–fluoro–3–nitro–benzoic acid, 2-Chloro-6-fluoro-3-nitro-benzoic acid, 95%, 2-Chloro-6-fluoro-3-nitrobenzoic acid, 97%, 97%. Offered by: Biosynth, AmBeed, GLPBio, Fluorochem, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 10g, 100mg, 1g.
2-chloro-6-fluoro-3-nitrobenzoic acid (CAS 206884-30-2) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 2-chloro-6-fluoro-3-nitrobenzoic acid. InChIKey: KLIABKNSCATNJU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-nitrobenzoic acid |
| InChIKey | KLIABKNSCATNJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)C(=O)O)F |
Computed by PubChem (NCBI)