Products 129951-45-7
CAS 129951-45-7 appears in our catalog under these names: 4-Chloro-5-fluoro-2-nitrobenzoic Acid, 4–Chloro–5–fluoro–2–nitrobenzoic acid, 4-Chloro-5-fluoro-2-nitrobenzoic acid 95%, 4-Chloro-5-fluoro-2-nitrobenzoic acid, 95%, 95%, 4-Chloro-5-fluoro-2-nitrobenzoic acid, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g, 10g.
4-chloro-5-fluoro-2-nitrobenzoic acid (CAS 129951-45-7) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 4-chloro-5-fluoro-2-nitrobenzoic acid. InChIKey: GGTQVIUWLUDQKR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-nitrobenzoic acid |
| InChIKey | GGTQVIUWLUDQKR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)