Products 132992-43-9
CAS 132992-43-9 appears in our catalog under these names: 3-Chloro-4-fluoro-5-nitrobenzoic acid, 95%, 3-chloro-4-fluoro-5-nitrobenzoic acid, 3-Chloro-4-fluoro-5-nitrobenzoic acid 95%, 3-Chloro-4-Fluoro-5-Nitrobenzoic Acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g.
3-chloro-4-fluoro-5-nitrobenzoic acid (CAS 132992-43-9) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 3-chloro-4-fluoro-5-nitrobenzoic acid. InChIKey: FSXCNZDIJKLGGU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 3-chloro-4-fluoro-5-nitrobenzoic acid |
| InChIKey | FSXCNZDIJKLGGU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Cl)C(=O)O |
Computed by PubChem (NCBI)