Products 149903-77-5
CAS 149903-77-5 appears in our catalog under these names: 2-Chloro-5-fluoro-4-nitrobenzoic acid, 2-Chloro-5-fluoro-4-nitro-benzoic acid, 95%, 2-Chloro-5-fluoro-4-nitrobenzoic acid, 98%, 2-Chloro-5-fluoro-4-nitrobenzoic acid 95%, 2-Chloro-5-fluoro-4-nitrobenzoic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 10g, 5g, 250mg.
2-chloro-5-fluoro-4-nitrobenzoic acid (CAS 149903-77-5) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 2-chloro-5-fluoro-4-nitrobenzoic acid. InChIKey: LXUZKEKXMXCKHZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-nitrobenzoic acid |
| InChIKey | LXUZKEKXMXCKHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)