CAS 1153279-85-6 appears in our catalog under these names: 5-Chloro-2-fluoro-3-nitrobenzoic acid, 98%, 5-Chloro-2-fluoro-3-nitrobenzoic acid, 97%, 97%, 5-Chloro-2-fluoro-3-nitrobenzoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 2g, 25g.
5-chloro-2-fluoro-3-nitrobenzoic acid (CAS 1153279-85-6) is a chemical compound with the molecular formula C7H3ClFNO4 and a molecular weight of 219.55 g/mol. IUPAC name: 5-chloro-2-fluoro-3-nitrobenzoic acid. InChIKey: FFLWLOLRLIMBGA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO4 |
|---|---|
| Molecular weight | 219.55 g/mol |
| IUPAC name | 5-chloro-2-fluoro-3-nitrobenzoic acid |
| InChIKey | FFLWLOLRLIMBGA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)