CAS 114804-77-2 appears in our catalog under these names: 6-(Benzyloxy)-2-naphthoic acid, 6-(Benzyloxy)-2-naphthoic acid, 95%, 6-(Benzyloxy)-2-naphthoic acid, 98%, 6-(Benzyloxy)-2-naphthoic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
6-phenylmethoxynaphthalene-2-carboxylic acid (CAS 114804-77-2) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 6-phenylmethoxynaphthalene-2-carboxylic acid. InChIKey: ZAMRNNPFCAMROT-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 6-phenylmethoxynaphthalene-2-carboxylic acid |
| InChIKey | ZAMRNNPFCAMROT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)