CAS 132292-17-2 appears in our catalog under these names: 6-(4-Methoxyphenyl)-2-naphthoic acid, 95%, 6-(4-Methoxyphenyl)-2-naphthoic Acid, >95% (HPLC). Offered by: AmBeed, TRC. Available pack sizes: 5g, 1g, 100mg.
6-(4-methoxyphenyl)naphthalene-2-carboxylic acid (CAS 132292-17-2) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 6-(4-methoxyphenyl)naphthalene-2-carboxylic acid. InChIKey: QEPGBUJIDJTPFS-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)naphthalene-2-carboxylic acid |
| InChIKey | QEPGBUJIDJTPFS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(C=C2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)