CAS 55090-57-8 is the registry number for Phenyl 6-methoxy-2-naphthoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
Phenyl 6-methoxynaphthalene-2-carboxylate (CAS 55090-57-8) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: phenyl 6-methoxynaphthalene-2-carboxylate. InChIKey: XXLOFIMWPLUFRM-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | phenyl 6-methoxynaphthalene-2-carboxylate |
| InChIKey | XXLOFIMWPLUFRM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)