Products 55090-57-8

CAS 55090-57-8 is the registry number for Phenyl 6-methoxy-2-naphthoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

Phenyl 6-methoxynaphthalene-2-carboxylate (CAS 55090-57-8) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: phenyl 6-methoxynaphthalene-2-carboxylate. InChIKey: XXLOFIMWPLUFRM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O3
Molecular weight278.3 g/mol
IUPAC namephenyl 6-methoxynaphthalene-2-carboxylate
InChIKeyXXLOFIMWPLUFRM-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=C(C=C2)C(=O)OC3=CC=CC=C3

Computed by PubChem (NCBI)