CAS 87344-63-6 appears in our catalog under these names: 4-(Phenylmethoxy)-1-naphthalenecarboxylic acid, 95%, 4-(Benzyloxy)-1-naphthoic acid, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
4-phenylmethoxynaphthalene-1-carboxylic acid (CAS 87344-63-6) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 4-phenylmethoxynaphthalene-1-carboxylic acid. InChIKey: JMTFAIVHIUNGRO-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 4-phenylmethoxynaphthalene-1-carboxylic acid |
| InChIKey | JMTFAIVHIUNGRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)